C31H47N5O7 — CID 135091301
trans-(2S,5S)-11-[1-(2-ethoxyacetyl)piperidine-4-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135091301) has the molecular formula C31H47N5O7 and a molecular weight of 601.75 g/mol. Its IUPAC name is trans-(2S,5S)-11-[1-(2-ethoxyacetyl)piperidine-4-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-11-[1-(2-ethoxyacetyl)piperidine-4-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135091301 |
| Molecular Formula | C31H47N5O7 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | trans-(2S,5S)-11-[1-(2-ethoxyacetyl)piperidine-4-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | CCOCC(=O)N1CCC(C(=O)N2CCCNC(=O)[C@H](C)N(C)C(=O)[C@H](Cc3ccc(OC)cc3)NC(=O)CCC2)CC1 |
| InChI | InChI=1S/C31H47N5O7/c1-5-43-21-28(38)35-18-13-24(14-19-35)30(40)36-16-6-8-27(37)33-26(20-23-9-11-25(42-4)12-10-23)31(41)34(3)22(2)29(39)32-15-7-17-36/h9-12,22,24,26H,5-8,13-21H2,1-4H3,(H,32,39)(H,33,37)/t22-,26-/m0/s1 |
| InChIKey | QVQYKSJNUALJJO-NVQXNPDNSA-N |
| XLogP | 0.97 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |