C32H41N5O4S — CID 135088543
trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135088543) has the molecular formula C32H41N5O4S and a molecular weight of 591.78 g/mol. Its IUPAC name is trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135088543 |
| Molecular Formula | C32H41N5O4S |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)CCCN(Cc3cnc(-c4ccccc4C)s3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C32H41N5O4S/c1-22-9-5-6-10-27(22)31-34-20-26(42-31)21-37-17-7-11-29(38)35-28(19-24-12-14-25(41-4)15-13-24)32(40)36(3)23(2)30(39)33-16-8-18-37/h5-6,9-10,12-15,20,23,28H,7-8,11,16-19,21H2,1-4H3,(H,33,39)(H,35,38)/t23-,28-/m0/s1 |
| InChIKey | NMSFAIYUVZAYPW-FIPFOOKPSA-N |
| XLogP | 3.80 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |