C28H38N6O6 — CID 154917114
formic acid;4-[[(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-3,6,15-trioxo-1,4,7,11-tetrazacyclopentadec-11-yl]methyl]-1H-pyrrole-2-carbonitrile (PubChem CID 154917114) has the molecular formula C28H38N6O6 and a molecular weight of 554.65 g/mol. Its IUPAC name is formic acid;4-[[(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-3,6,15-trioxo-1,4,7,11-tetrazacyclopentadec-11-yl]methyl]-1H-pyrrole-2-carbonitrile.
| Compound Name | formic acid;4-[[(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-3,6,15-trioxo-1,4,7,11-tetrazacyclopentadec-11-yl]methyl]-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 154917114 |
| Molecular Formula | C28H38N6O6 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | formic acid;4-[[(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-3,6,15-trioxo-1,4,7,11-tetrazacyclopentadec-11-yl]methyl]-1H-pyrrole-2-carbonitrile |
| SMILES | COc1ccc(C[C@@H]2NC(=O)CCCN(Cc3c[nH]c(C#N)c3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1.O=CO |
| InChI | InChI=1S/C27H36N6O4.CH2O2/c1-19-26(35)29-11-5-13-33(18-21-14-22(16-28)30-17-21)12-4-6-25(34)31-24(27(36)32(19)2)15-20-7-9-23(37-3)10-8-20;2-1-3/h7-10,14,17,19,24,30H,4-6,11-13,15,18H2,1-3H3,(H,29,35)(H,31,34);1H,(H,2,3)/t19-,24-;/m0./s1 |
| InChIKey | JPWBEMDXMHFZPF-RIAYWLAYSA-N |
| XLogP | 1.27 |
| TPSA | 167.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|