C30H47N5O7 — CID 135096050
(2R,5S,8S)-14-(2-methoxyacetyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone (PubChem CID 135096050) has the molecular formula C30H47N5O7 and a molecular weight of 589.73 g/mol. Its IUPAC name is (2R,5S,8S)-14-(2-methoxyacetyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone.
| Compound Name | (2R,5S,8S)-14-(2-methoxyacetyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
|---|---|
| PubChem CID | 135096050 |
| Molecular Formula | C30H47N5O7 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | (2R,5S,8S)-14-(2-methoxyacetyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
| SMILES | COCC(=O)N1CCCNC(=O)[C@H](C)N(C)C(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)[C@@H](CC(C)C)NC(=O)CCC1 |
| InChI | InChI=1S/C30H47N5O7/c1-20(2)17-24-29(39)33-25(18-22-10-12-23(42-6)13-11-22)30(40)34(4)21(3)28(38)31-14-8-16-35(27(37)19-41-5)15-7-9-26(36)32-24/h10-13,20-21,24-25H,7-9,14-19H2,1-6H3,(H,31,38)(H,32,36)(H,33,39)/t21-,24+,25-/m0/s1 |
| InChIKey | HMMSUDVUVZBNPY-GPUOULLFSA-N |
| XLogP | 0.88 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |