C32H48N6O8S — CID 135106095
(2R,5S,8S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone (PubChem CID 135106095) has the molecular formula C32H48N6O8S and a molecular weight of 676.84 g/mol. Its IUPAC name is (2R,5S,8S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone.
| Compound Name | (2R,5S,8S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
|---|---|
| PubChem CID | 135106095 |
| Molecular Formula | C32H48N6O8S |
| Molecular Weight | 676.84 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | (2R,5S,8S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H](CC(C)C)NC(=O)CCCN(S(=O)(=O)c3c(C)noc3C)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C32H48N6O8S/c1-20(2)18-26-31(41)35-27(19-24-11-13-25(45-7)14-12-24)32(42)37(6)22(4)30(40)33-15-9-17-38(16-8-10-28(39)34-26)47(43,44)29-21(3)36-46-23(29)5/h11-14,20,22,26-27H,8-10,15-19H2,1-7H3,(H,33,40)(H,34,39)(H,35,41)/t22-,26+,27-/m0/s1 |
| InChIKey | CZJBCLMPVNYLJG-FDJWOJMMSA-N |
| XLogP | 1.70 |
| TPSA | 180.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.84 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |