C26H34N6O6S — CID 135100879
cis-(2S,5R)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135100879) has the molecular formula C26H34N6O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is cis-(2S,5R)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2S,5R)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135100879 |
| Molecular Formula | C26H34N6O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | cis-(2S,5R)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](C)NC(=O)CCC1 |
| InChI | InChI=1S/C26H34N6O6S/c1-16-24(18(3)38-31-16)39(36,37)32-12-6-10-23(33)29-17(2)25(34)30-22(26(35)27-11-7-13-32)14-19-15-28-21-9-5-4-8-20(19)21/h4-5,8-9,15,17,22,28H,6-7,10-14H2,1-3H3,(H,27,35)(H,29,33)(H,30,34)/t17-,22+/m0/s1 |
| InChIKey | JGFKGSBHCZJCSC-HTAPYJJXSA-N |
| XLogP | 1.30 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |