C30H35N7O4 — CID 135088778
cis-(2S,5R)-11-(2-indazol-1-ylacetyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135088778) has the molecular formula C30H35N7O4 and a molecular weight of 557.66 g/mol. Its IUPAC name is cis-(2S,5R)-11-(2-indazol-1-ylacetyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2S,5R)-11-(2-indazol-1-ylacetyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135088778 |
| Molecular Formula | C30H35N7O4 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | cis-(2S,5R)-11-(2-indazol-1-ylacetyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | C[C@@H]1NC(=O)CCCN(C(=O)Cn2ncc3ccccc32)CCCNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C30H35N7O4/c1-20-29(40)35-25(16-22-17-32-24-10-4-3-9-23(22)24)30(41)31-13-7-15-36(14-6-12-27(38)34-20)28(39)19-37-26-11-5-2-8-21(26)18-33-37/h2-5,8-11,17-18,20,25,32H,6-7,12-16,19H2,1H3,(H,31,41)(H,34,38)(H,35,40)/t20-,25+/m0/s1 |
| InChIKey | CFSXCIAQVIBZOT-NBGIEHNGSA-N |
| XLogP | 1.88 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |