C28H33N7O4S — CID 135099282
cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135099282) has the molecular formula C28H33N7O4S and a molecular weight of 563.68 g/mol. Its IUPAC name is cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135099282 |
| Molecular Formula | C28H33N7O4S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | Cc1nc2sccn2c1C(=O)N1CCCNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](C)NC(=O)CCC1 |
| InChI | InChI=1S/C28H33N7O4S/c1-17-24(35-13-14-40-28(35)32-17)27(39)34-11-5-9-23(36)31-18(2)25(37)33-22(26(38)29-10-6-12-34)15-19-16-30-21-8-4-3-7-20(19)21/h3-4,7-8,13-14,16,18,22,30H,5-6,9-12,15H2,1-2H3,(H,29,38)(H,31,36)(H,33,37)/t18-,22+/m0/s1 |
| InChIKey | GSAAFHQNIUUGOB-PGRDOPGGSA-N |
| XLogP | 2.16 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |