C34H37N7O5 — CID 135112583
(3S,6S,9R,12R)-3-benzyl-9-(1H-indol-3-ylmethyl)-6,12-dimethyl-13-(pyridine-2-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 135112583) has the molecular formula C34H37N7O5 and a molecular weight of 623.71 g/mol. Its IUPAC name is (3S,6S,9R,12R)-3-benzyl-9-(1H-indol-3-ylmethyl)-6,12-dimethyl-13-(pyridine-2-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9R,12R)-3-benzyl-9-(1H-indol-3-ylmethyl)-6,12-dimethyl-13-(pyridine-2-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135112583 |
| Molecular Formula | C34H37N7O5 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | (3S,6S,9R,12R)-3-benzyl-9-(1H-indol-3-ylmethyl)-6,12-dimethyl-13-(pyridine-2-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | C[C@@H]1NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](C)N(C(=O)c2ccccn2)CCNC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C34H37N7O5/c1-21-30(42)39-28(18-23-10-4-3-5-11-23)32(44)36-16-17-41(34(46)27-14-8-9-15-35-27)22(2)31(43)40-29(33(45)38-21)19-24-20-37-26-13-7-6-12-25(24)26/h3-15,20-22,28-29,37H,16-19H2,1-2H3,(H,36,44)(H,38,45)(H,39,42)(H,40,43)/t21-,22+,28-,29+/m0/s1 |
| InChIKey | LRXPGYRRLSMFNK-IVBVTWBMSA-N |
| XLogP | 1.48 |
| TPSA | 165.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |