C27H34N6O5 — CID 135099513
cis-(2S,5R)-11-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135099513) has the molecular formula C27H34N6O5 and a molecular weight of 522.61 g/mol. Its IUPAC name is cis-(2S,5R)-11-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2S,5R)-11-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135099513 |
| Molecular Formula | C27H34N6O5 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | cis-(2S,5R)-11-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-5-(1H-indol-3-ylmethyl)-2-methyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | Cc1noc(C)c1C(=O)N1CCCNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](C)NC(=O)CCC1 |
| InChI | InChI=1S/C27H34N6O5/c1-16-24(18(3)38-32-16)27(37)33-12-6-10-23(34)30-17(2)25(35)31-22(26(36)28-11-7-13-33)14-19-15-29-21-9-5-4-8-20(19)21/h4-5,8-9,15,17,22,29H,6-7,10-14H2,1-3H3,(H,28,36)(H,30,34)(H,31,35)/t17-,22+/m0/s1 |
| InChIKey | LLTBLLZRDQSNBQ-HTAPYJJXSA-N |
| XLogP | 1.75 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |