C29H35N7O4 — CID 135118960
cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135118960) has the molecular formula C29H35N7O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135118960 |
| Molecular Formula | C29H35N7O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | cis-(2S,5R)-5-(1H-indol-3-ylmethyl)-2-methyl-11-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | C[C@@H]1NC(=O)CCCN(Cc2ccc(-c3ccn[nH]3)o2)CCCNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C29H35N7O4/c1-19-28(38)34-25(16-20-17-31-23-7-3-2-6-22(20)23)29(39)30-12-5-15-36(14-4-8-27(37)33-19)18-21-9-10-26(40-21)24-11-13-32-35-24/h2-3,6-7,9-11,13,17,19,25,31H,4-5,8,12,14-16,18H2,1H3,(H,30,39)(H,32,35)(H,33,37)(H,34,38)/t19-,25+/m0/s1 |
| InChIKey | XTYDHTNGTMAXND-UQBPGWFLSA-N |
| XLogP | 2.49 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |