C35H49N5O6 — CID 134957975
(3S,6S,9S,12S)-12-benzyl-9,10-dimethyl-6-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-propan-2-yl-1,4,7,10,13-pentazacycloheptadecane-2,5,8,11,14-pentone (PubChem CID 134957975) has the molecular formula C35H49N5O6 and a molecular weight of 635.81 g/mol. Its IUPAC name is (3S,6S,9S,12S)-12-benzyl-9,10-dimethyl-6-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-propan-2-yl-1,4,7,10,13-pentazacycloheptadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,6S,9S,12S)-12-benzyl-9,10-dimethyl-6-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-propan-2-yl-1,4,7,10,13-pentazacycloheptadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 134957975 |
| Molecular Formula | C35H49N5O6 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.37 |
| IUPAC Name | (3S,6S,9S,12S)-12-benzyl-9,10-dimethyl-6-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-propan-2-yl-1,4,7,10,13-pentazacycloheptadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](Cc2ccc(OC(C)(C)C)cc2)NC(=O)[C@H](C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)CCCNC1=O |
| InChI | InChI=1S/C35H49N5O6/c1-22(2)30-33(44)36-19-11-14-29(41)37-28(21-24-12-9-8-10-13-24)34(45)40(7)23(3)31(42)38-27(32(43)39-30)20-25-15-17-26(18-16-25)46-35(4,5)6/h8-10,12-13,15-18,22-23,27-28,30H,11,14,19-21H2,1-7H3,(H,36,44)(H,37,41)(H,38,42)(H,39,43)/t23-,27-,28-,30-/m0/s1 |
| InChIKey | MILLEIKIBAXFMF-ZQLNIIGMSA-N |
| XLogP | 2.52 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |