C36H50N4O6 — CID 160765375
(3S,6S,9S,17S)-9-benzyl-6,7-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-17-propan-2-yl-1,4,7,10-tetrazacycloheptadecane-2,5,8,11,16-pentone (PubChem CID 160765375) has the molecular formula C36H50N4O6 and a molecular weight of 634.82 g/mol. Its IUPAC name is (3S,6S,9S,17S)-9-benzyl-6,7-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-17-propan-2-yl-1,4,7,10-tetrazacycloheptadecane-2,5,8,11,16-pentone.
| Compound Name | (3S,6S,9S,17S)-9-benzyl-6,7-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-17-propan-2-yl-1,4,7,10-tetrazacycloheptadecane-2,5,8,11,16-pentone |
|---|---|
| PubChem CID | 160765375 |
| Molecular Formula | C36H50N4O6 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | (3S,6S,9S,17S)-9-benzyl-6,7-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-17-propan-2-yl-1,4,7,10-tetrazacycloheptadecane-2,5,8,11,16-pentone |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](Cc2ccc(OC(C)(C)C)cc2)NC(=O)[C@H](C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)CCCCC1=O |
| InChI | InChI=1S/C36H50N4O6/c1-23(2)32-30(41)15-11-12-16-31(42)37-29(22-25-13-9-8-10-14-25)35(45)40(7)24(3)33(43)38-28(34(44)39-32)21-26-17-19-27(20-18-26)46-36(4,5)6/h8-10,13-14,17-20,23-24,28-29,32H,11-12,15-16,21-22H2,1-7H3,(H,37,42)(H,38,43)(H,39,44)/t24-,28-,29-,32-/m0/s1 |
| InChIKey | RYPRRIHMLMGXOX-LTYDCPJSSA-N |
| XLogP | 3.75 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |