C30H42N4O3 — CID 134150696
10-benzyl-4-butan-2-yl-6,7-dimethyl-3,6,9,12-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-5,8,11-trione (PubChem CID 134150696) has the molecular formula C30H42N4O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is 10-benzyl-4-butan-2-yl-6,7-dimethyl-3,6,9,12-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-5,8,11-trione.
| Compound Name | 10-benzyl-4-butan-2-yl-6,7-dimethyl-3,6,9,12-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-5,8,11-trione |
|---|---|
| PubChem CID | 134150696 |
| Molecular Formula | C30H42N4O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | 10-benzyl-4-butan-2-yl-6,7-dimethyl-3,6,9,12-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-5,8,11-trione |
| SMILES | CCC(C)C1NCc2ccccc2CCCCNC(=O)C(Cc2ccccc2)NC(=O)C(C)N(C)C1=O |
| InChI | InChI=1S/C30H42N4O3/c1-5-21(2)27-30(37)34(4)22(3)28(35)33-26(19-23-13-7-6-8-14-23)29(36)31-18-12-11-16-24-15-9-10-17-25(24)20-32-27/h6-10,13-15,17,21-22,26-27,32H,5,11-12,16,18-20H2,1-4H3,(H,31,36)(H,33,35) |
| InChIKey | FHULYONJTIYIJE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |