C27H44N4O4 — CID 134143044
(6S,9R,12R)-6,12-bis[(2S)-butan-2-yl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 134143044) has the molecular formula C27H44N4O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (6S,9R,12R)-6,12-bis[(2S)-butan-2-yl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6S,9R,12R)-6,12-bis[(2S)-butan-2-yl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 134143044 |
| Molecular Formula | C27H44N4O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (6S,9R,12R)-6,12-bis[(2S)-butan-2-yl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC[C@H](C)[C@@H]1NCCOc2ccccc2CCCNC(=O)[C@@H]([C@@H](C)CC)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C27H44N4O4/c1-7-18(3)23-26(33)29-15-11-13-21-12-9-10-14-22(21)35-17-16-28-24(19(4)8-2)27(34)31(6)20(5)25(32)30-23/h9-10,12,14,18-20,23-24,28H,7-8,11,13,15-17H2,1-6H3,(H,29,33)(H,30,32)/t18-,19-,20+,23+,24-/m0/s1 |
| InChIKey | BKXYALZSNJMXIV-OMDOPDFPSA-N |
| XLogP | 2.51 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |