C29H42N4O5 — CID 145499004
6-butan-2-yl-8-methyl-12-phenyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;methanol (PubChem CID 145499004) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is 6-butan-2-yl-8-methyl-12-phenyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;methanol.
| Compound Name | 6-butan-2-yl-8-methyl-12-phenyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;methanol |
|---|---|
| PubChem CID | 145499004 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 6-butan-2-yl-8-methyl-12-phenyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione;methanol |
| SMILES | CCC(C)C1NCCOc2ccccc2CCCNC(=O)C(c2ccccc2)NC(=O)CN(C)C1=O.CO |
| InChI | InChI=1S/C28H38N4O4.CH4O/c1-4-20(2)25-28(35)32(3)19-24(33)31-26(22-12-6-5-7-13-22)27(34)30-16-10-14-21-11-8-9-15-23(21)36-18-17-29-25;1-2/h5-9,11-13,15,20,25-26,29H,4,10,14,16-19H2,1-3H3,(H,30,34)(H,31,33);2H,1H3 |
| InChIKey | MIIHYAGVEDBRSD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |