C26H42N4O3 — CID 143377061
(10Z)-6-butan-2-yl-10-butan-2-ylidene-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione (PubChem CID 143377061) has the molecular formula C26H42N4O3 and a molecular weight of 458.65 g/mol. Its IUPAC name is (10Z)-6-butan-2-yl-10-butan-2-ylidene-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione.
| Compound Name | (10Z)-6-butan-2-yl-10-butan-2-ylidene-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione |
|---|---|
| PubChem CID | 143377061 |
| Molecular Formula | C26H42N4O3 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | (10Z)-6-butan-2-yl-10-butan-2-ylidene-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,13-dione |
| SMILES | CC/C(C)=C1/CN(C)C(=O)C(C(C)CC)NCCOc2ccccc2CCCNC(=O)CN1 |
| InChI | InChI=1S/C26H42N4O3/c1-6-19(3)22-18-30(5)26(32)25(20(4)7-2)28-15-16-33-23-13-9-8-11-21(23)12-10-14-27-24(31)17-29-22/h8-9,11,13,20,25,28-29H,6-7,10,12,14-18H2,1-5H3,(H,27,31)/b22-19- |
| InChIKey | HVWFAKYMKWQHSB-QOCHGBHMSA-N |
| XLogP | 2.86 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |