C30H42N4O5 — CID 11584669
(6S,9R,12R)-12-benzyl-6-butan-2-yl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 11584669) has the molecular formula C30H42N4O5 and a molecular weight of 538.69 g/mol. Its IUPAC name is (6S,9R,12R)-12-benzyl-6-butan-2-yl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6S,9R,12R)-12-benzyl-6-butan-2-yl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 11584669 |
| Molecular Formula | C30H42N4O5 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | (6S,9R,12R)-12-benzyl-6-butan-2-yl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CCC(C)[C@@H]1NCCOc2ccccc2CCCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CO)N(C)C1=O |
| InChI | InChI=1S/C30H42N4O5/c1-4-21(2)27-30(38)34(3)25(20-35)29(37)33-24(19-22-11-6-5-7-12-22)28(36)32-16-10-14-23-13-8-9-15-26(23)39-18-17-31-27/h5-9,11-13,15,21,24-25,27,31,35H,4,10,14,16-20H2,1-3H3,(H,32,36)(H,33,37)/t21?,24-,25-,27+/m1/s1 |
| InChIKey | XWHHHOXGPJZCNQ-KHPAOSQTSA-N |
| XLogP | 1.68 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |