C25H38N4O5 — CID 143377046
(17Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[17.4.0]tricosa-1(23),17,19,21-tetraene-7,10,13-trione (PubChem CID 143377046) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (17Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[17.4.0]tricosa-1(23),17,19,21-tetraene-7,10,13-trione.
| Compound Name | (17Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[17.4.0]tricosa-1(23),17,19,21-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 143377046 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (17Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[17.4.0]tricosa-1(23),17,19,21-tetraene-7,10,13-trione |
| SMILES | CCC(C)C1NCCOc2ccccc2/C=C\CCNC(=O)CNC(=O)C(C(C)O)N(C)C1=O |
| InChI | InChI=1S/C25H38N4O5/c1-5-17(2)22-25(33)29(4)23(18(3)30)24(32)28-16-21(31)26-13-9-8-11-19-10-6-7-12-20(19)34-15-14-27-22/h6-8,10-12,17-18,22-23,27,30H,5,9,13-16H2,1-4H3,(H,26,31)(H,28,32)/b11-8- |
| InChIKey | CRSLZDGUVKBZJV-FLIBITNWSA-N |
| XLogP | 0.93 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |