C26H38N4O5 — CID 143377181
(16E)-6-cyclohexyl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione (PubChem CID 143377181) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is (16E)-6-cyclohexyl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione.
| Compound Name | (16E)-6-cyclohexyl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 143377181 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (16E)-6-cyclohexyl-9-(1-hydroxyethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
| SMILES | CC(O)C1C(=O)NCC(=O)NC/C=C/c2ccccc2OCCNC(C2CCCCC2)C(=O)N1C |
| InChI | InChI=1S/C26H38N4O5/c1-18(31)24-25(33)29-17-22(32)27-14-8-12-19-9-6-7-13-21(19)35-16-15-28-23(26(34)30(24)2)20-10-4-3-5-11-20/h6-9,12-13,18,20,23-24,28,31H,3-5,10-11,14-17H2,1-2H3,(H,27,32)(H,29,33)/b12-8+ |
| InChIKey | MKWZWUYOKPPQQD-XYOKQWHBSA-N |
| XLogP | 1.07 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |