C32H41ClN4O5 — CID 90837148
(6S,9S,12R)-12-[(4-chlorophenyl)methyl]-6-cyclohexyl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione (PubChem CID 90837148) has the molecular formula C32H41ClN4O5 and a molecular weight of 597.16 g/mol. Its IUPAC name is (6S,9S,12R)-12-[(4-chlorophenyl)methyl]-6-cyclohexyl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione.
| Compound Name | (6S,9S,12R)-12-[(4-chlorophenyl)methyl]-6-cyclohexyl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 90837148 |
| Molecular Formula | C32H41ClN4O5 |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | (6S,9S,12R)-12-[(4-chlorophenyl)methyl]-6-cyclohexyl-9-(hydroxymethyl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
| SMILES | CN1C(=O)[C@H](C2CCCCC2)NCCOc2ccccc2C=CCNC(=O)[C@@H](Cc2ccc(Cl)cc2)NC(=O)[C@@H]1CO |
| InChI | InChI=1S/C32H41ClN4O5/c1-37-27(21-38)31(40)36-26(20-22-13-15-25(33)16-14-22)30(39)35-17-7-11-23-8-5-6-12-28(23)42-19-18-34-29(32(37)41)24-9-3-2-4-10-24/h5-8,11-16,24,26-27,29,34,38H,2-4,9-10,17-21H2,1H3,(H,35,39)(H,36,40)/t26-,27+,29+/m1/s1 |
| InChIKey | ISEMOGOWTCFUGI-XQFUHLNNSA-N |
| XLogP | 2.95 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |