C32H42N4O6 — CID 91117836
(6S,9S,12R)-6-cyclohexyl-9-(hydroxymethyl)-12-[(4-hydroxyphenyl)methyl]-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione (PubChem CID 91117836) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is (6S,9S,12R)-6-cyclohexyl-9-(hydroxymethyl)-12-[(4-hydroxyphenyl)methyl]-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione.
| Compound Name | (6S,9S,12R)-6-cyclohexyl-9-(hydroxymethyl)-12-[(4-hydroxyphenyl)methyl]-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 91117836 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | (6S,9S,12R)-6-cyclohexyl-9-(hydroxymethyl)-12-[(4-hydroxyphenyl)methyl]-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
| SMILES | CN1C(=O)[C@H](C2CCCCC2)NCCOc2ccccc2C=CCNC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)[C@@H]1CO |
| InChI | InChI=1S/C32H42N4O6/c1-36-27(21-37)31(40)35-26(20-22-13-15-25(38)16-14-22)30(39)34-17-7-11-23-8-5-6-12-28(23)42-19-18-33-29(32(36)41)24-9-3-2-4-10-24/h5-8,11-16,24,26-27,29,33,37-38H,2-4,9-10,17-21H2,1H3,(H,34,39)(H,35,40)/t26-,27+,29+/m1/s1 |
| InChIKey | IBQOYAPWRLKGHY-XQFUHLNNSA-N |
| XLogP | 2.00 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |