C30H39FN4O4 — CID 89473243
(9R,12R)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-8,9,16-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 89473243) has the molecular formula C30H39FN4O4 and a molecular weight of 538.66 g/mol. Its IUPAC name is (9R,12R)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-8,9,16-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (9R,12R)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-8,9,16-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 89473243 |
| Molecular Formula | C30H39FN4O4 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | (9R,12R)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-8,9,16-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC1CNC(=O)[C@@H](Cc2ccc(F)cc2)NC(=O)[C@@H](C)N(C)C(=O)C(C2CC2)NCCOc2ccccc2C1 |
| InChI | InChI=1S/C30H39FN4O4/c1-19-16-23-6-4-5-7-26(23)39-15-14-32-27(22-10-11-22)30(38)35(3)20(2)28(36)34-25(29(37)33-18-19)17-21-8-12-24(31)13-9-21/h4-9,12-13,19-20,22,25,27,32H,10-11,14-18H2,1-3H3,(H,33,37)(H,34,36)/t19?,20-,25-,27?/m1/s1 |
| InChIKey | XNKJWNJIPRCJSB-ONOYFXQYSA-N |
| XLogP | 2.46 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |