C31H40FN4O4- — CID 145499059
(3R,6S,9R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-7,13-dioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),10,18,20-tetraen-10-olate (PubChem CID 145499059) has the molecular formula C31H40FN4O4- and a molecular weight of 551.68 g/mol. Its IUPAC name is (3R,6S,9R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-7,13-dioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),10,18,20-tetraen-10-olate.
| Compound Name | (3R,6S,9R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-7,13-dioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),10,18,20-tetraen-10-olate |
|---|---|
| PubChem CID | 145499059 |
| Molecular Formula | C31H40FN4O4- |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | (3R,6S,9R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-7,13-dioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),10,18,20-tetraen-10-olate |
| SMILES | C[C@@H]1CNC(=O)C(Cc2ccc(F)cc2)/N=C(\[O-])[C@@H](C)N(C)C(=O)[C@H](C2CC2)NC[C@@H](C)Oc2ccccc2C1 |
| InChI | InChI=1S/C31H41FN4O4/c1-19-15-24-7-5-6-8-27(24)40-20(2)18-33-28(23-11-12-23)31(39)36(4)21(3)29(37)35-26(30(38)34-17-19)16-22-9-13-25(32)14-10-22/h5-10,13-14,19-21,23,26,28,33H,11-12,15-18H2,1-4H3,(H,34,38)(H,35,37)/p-1/t19-,20+,21+,26?,28-/m0/s1 |
| InChIKey | PEHXHBVSBOYZLV-MKHYALFESA-M |
| XLogP | 2.49 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |