C30H40FN5O4 — CID 59778842
(3R,6S,9R,12R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 59778842) has the molecular formula C30H40FN5O4 and a molecular weight of 553.68 g/mol. Its IUPAC name is (3R,6S,9R,12R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 59778842 |
| Molecular Formula | C30H40FN5O4 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | (3R,6S,9R,12R,16S)-6-cyclopropyl-12-[(4-fluorophenyl)methyl]-3,8,9,16-tetramethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | C[C@@H]1CNC(=O)[C@@H](Cc2ccc(F)cc2)NC(=O)[C@@H](C)N(C)C(=O)[C@H](C2CC2)NC[C@@H](C)Oc2cccnc2C1 |
| InChI | InChI=1S/C30H40FN5O4/c1-18-14-24-26(6-5-13-32-24)40-19(2)17-33-27(22-9-10-22)30(39)36(4)20(3)28(37)35-25(29(38)34-16-18)15-21-7-11-23(31)12-8-21/h5-8,11-13,18-20,22,25,27,33H,9-10,14-17H2,1-4H3,(H,34,38)(H,35,37)/t18-,19+,20+,25+,27-/m0/s1 |
| InChIKey | NPRZXXQZESUDQC-UXNVPJIUSA-N |
| XLogP | 2.24 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |