C30H38N6O4 — CID 123205661
4-[[(6S,9R,12R)-6-cyclopropyl-8,9-dimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraen-12-yl]methyl]benzenecarboximidamide (PubChem CID 123205661) has the molecular formula C30H38N6O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 4-[[(6S,9R,12R)-6-cyclopropyl-8,9-dimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraen-12-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[(6S,9R,12R)-6-cyclopropyl-8,9-dimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraen-12-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123205661 |
| Molecular Formula | C30H38N6O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 4-[[(6S,9R,12R)-6-cyclopropyl-8,9-dimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraen-12-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H]2NC(=O)[C@@H](C)N(C)C(=O)[C@H](C3CC3)NCCOc3ccccc3C=CCNC2=O)cc1 |
| InChI | InChI=1S/C30H38N6O4/c1-19-28(37)35-24(18-20-9-11-23(12-10-20)27(31)32)29(38)34-15-5-7-21-6-3-4-8-25(21)40-17-16-33-26(22-13-14-22)30(39)36(19)2/h3-12,19,22,24,26,33H,13-18H2,1-2H3,(H3,31,32)(H,34,38)(H,35,37)/t19-,24-,26+/m1/s1 |
| InChIKey | HWGJSWJAWUIVCI-OXTYCOSGSA-N |
| XLogP | 1.44 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|