C25H36N4O4 — CID 143377343
(9S,16E)-6-cyclohexyl-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione (PubChem CID 143377343) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is (9S,16E)-6-cyclohexyl-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione.
| Compound Name | (9S,16E)-6-cyclohexyl-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 143377343 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (9S,16E)-6-cyclohexyl-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
| SMILES | C[C@H]1C(=O)NCC(=O)NC/C=C/c2ccccc2OCCNC(C2CCCCC2)C(=O)N1C |
| InChI | InChI=1S/C25H36N4O4/c1-18-24(31)28-17-22(30)26-14-8-12-19-9-6-7-13-21(19)33-16-15-27-23(25(32)29(18)2)20-10-4-3-5-11-20/h6-9,12-13,18,20,23,27H,3-5,10-11,14-17H2,1-2H3,(H,26,30)(H,28,31)/b12-8+/t18-,23?/m0/s1 |
| InChIKey | VBHMSVVTGQCDEO-QXYYHAPZSA-N |
| XLogP | 1.71 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |