C32H46N4O6 — CID 143377243
(16E)-6-butan-2-yl-9-(2-hydroxypropan-2-yl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione;4-methylphenol (PubChem CID 143377243) has the molecular formula C32H46N4O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is (16E)-6-butan-2-yl-9-(2-hydroxypropan-2-yl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione;4-methylphenol.
| Compound Name | (16E)-6-butan-2-yl-9-(2-hydroxypropan-2-yl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione;4-methylphenol |
|---|---|
| PubChem CID | 143377243 |
| Molecular Formula | C32H46N4O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | (16E)-6-butan-2-yl-9-(2-hydroxypropan-2-yl)-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione;4-methylphenol |
| SMILES | CCC(C)C1NCCOc2ccccc2/C=C/CNC(=O)CNC(=O)C(C(C)(C)O)N(C)C1=O.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H38N4O5.C7H8O/c1-6-17(2)21-24(32)29(5)22(25(3,4)33)23(31)28-16-20(30)26-13-9-11-18-10-7-8-12-19(18)34-15-14-27-21;1-6-2-4-7(8)5-3-6/h7-12,17,21-22,27,33H,6,13-16H2,1-5H3,(H,26,30)(H,28,31);2-5,8H,1H3/b11-9+; |
| InChIKey | FPENWVLKWNQZGE-LBEJWNQZSA-N |
| XLogP | 2.63 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |