C30H40N4O4S — CID 134132519
(6S,12S,16Z)-6-[(2S)-butan-2-yl]-12-(thiophen-3-ylmethyl)spiro[2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-9,1'-cyclopentane]-7,10,13-trione (PubChem CID 134132519) has the molecular formula C30H40N4O4S and a molecular weight of 552.74 g/mol. Its IUPAC name is (6S,12S,16Z)-6-[(2S)-butan-2-yl]-12-(thiophen-3-ylmethyl)spiro[2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-9,1'-cyclopentane]-7,10,13-trione.
| Compound Name | (6S,12S,16Z)-6-[(2S)-butan-2-yl]-12-(thiophen-3-ylmethyl)spiro[2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-9,1'-cyclopentane]-7,10,13-trione |
|---|---|
| PubChem CID | 134132519 |
| Molecular Formula | C30H40N4O4S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | (6S,12S,16Z)-6-[(2S)-butan-2-yl]-12-(thiophen-3-ylmethyl)spiro[2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-9,1'-cyclopentane]-7,10,13-trione |
| SMILES | CC[C@H](C)[C@@H]1NCCOc2ccccc2/C=C\CNC(=O)[C@H](Cc2ccsc2)NC(=O)C2(CCCC2)NC1=O |
| InChI | InChI=1S/C30H40N4O4S/c1-3-21(2)26-28(36)34-30(13-6-7-14-30)29(37)33-24(19-22-12-18-39-20-22)27(35)32-15-8-10-23-9-4-5-11-25(23)38-17-16-31-26/h4-5,8-12,18,20-21,24,26,31H,3,6-7,13-17,19H2,1-2H3,(H,32,35)(H,33,37)(H,34,36)/b10-8-/t21-,24-,26-/m0/s1 |
| InChIKey | AAOVZOGFZYRKIP-MVFPVBCMSA-N |
| XLogP | 3.43 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |