C32H39ClN4O4 — CID 25182055
CID 25182055 (PubChem CID 25182055) has the molecular formula C32H39ClN4O4 and a molecular weight of 579.14 g/mol.
| Compound Name | CID 25182055 |
|---|---|
| PubChem CID | 25182055 |
| Molecular Formula | C32H39ClN4O4 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | — |
| SMILES | O=C1NC/C=C/c2ccccc2OCCNC2(CCCC2)C(=O)NC2(CCCC2)C(=O)N[C@H]1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C32H39ClN4O4/c33-25-12-7-9-23(21-25)22-26-28(38)34-18-8-11-24-10-1-2-13-27(24)41-20-19-35-31(14-3-4-15-31)30(40)37-32(29(39)36-26)16-5-6-17-32/h1-2,7-13,21,26,35H,3-6,14-20,22H2,(H,34,38)(H,36,39)(H,37,40)/b11-8+/t26-/m0/s1 |
| InChIKey | MTGASXKPLWBSEL-MLYOZINFSA-N |
| XLogP | 3.92 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |