C34H45FN4O4 — CID 24969064
(7R,10R,13S,16R)-13-cyclohexyl-7-[(4-fluorophenyl)methyl]-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione (PubChem CID 24969064) has the molecular formula C34H45FN4O4 and a molecular weight of 592.76 g/mol. Its IUPAC name is (7R,10R,13S,16R)-13-cyclohexyl-7-[(4-fluorophenyl)methyl]-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione.
| Compound Name | (7R,10R,13S,16R)-13-cyclohexyl-7-[(4-fluorophenyl)methyl]-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione |
|---|---|
| PubChem CID | 24969064 |
| Molecular Formula | C34H45FN4O4 |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | (7R,10R,13S,16R)-13-cyclohexyl-7-[(4-fluorophenyl)methyl]-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione |
| SMILES | C[C@@H]1C(=O)N[C@H](Cc2ccc(F)cc2)C(=O)NCCCc2cccc3c2O[C@H](CC3)CN[C@@H](C2CCCCC2)C(=O)N1C |
| InChI | InChI=1S/C34H45FN4O4/c1-22-32(40)38-29(20-23-13-16-27(35)17-14-23)33(41)36-19-7-12-25-10-6-11-26-15-18-28(43-31(25)26)21-37-30(34(42)39(22)2)24-8-4-3-5-9-24/h6,10-11,13-14,16-17,22,24,28-30,37H,3-5,7-9,12,15,18-21H2,1-2H3,(H,36,41)(H,38,40)/t22-,28-,29-,30+/m1/s1 |
| InChIKey | CCLHNHVOQYDEKK-UFQBDYIMSA-N |
| XLogP | 3.69 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |