C35H45ClN4O3 — CID 163849201
(7R,10R,13S)-7-[(4-chlorophenyl)methyl]-9-cyclobutylidene-13-cyclopropyl-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione (PubChem CID 163849201) has the molecular formula C35H45ClN4O3 and a molecular weight of 605.22 g/mol. Its IUPAC name is (7R,10R,13S)-7-[(4-chlorophenyl)methyl]-9-cyclobutylidene-13-cyclopropyl-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione.
| Compound Name | (7R,10R,13S)-7-[(4-chlorophenyl)methyl]-9-cyclobutylidene-13-cyclopropyl-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione |
|---|---|
| PubChem CID | 163849201 |
| Molecular Formula | C35H45ClN4O3 |
| Molecular Weight | 605.22 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | (7R,10R,13S)-7-[(4-chlorophenyl)methyl]-9-cyclobutylidene-13-cyclopropyl-10,11-dimethyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione |
| SMILES | C[C@@H]1C(=C2CCC2)N[C@H](Cc2ccc(Cl)cc2)C(=O)NCCCc2cccc3c2OC(CC3)CN[C@@H](C2CC2)C(=O)N1C |
| InChI | InChI=1S/C35H45ClN4O3/c1-22-31(24-6-3-7-24)39-30(20-23-11-16-28(36)17-12-23)34(41)37-19-5-10-26-8-4-9-27-15-18-29(43-33(26)27)21-38-32(25-13-14-25)35(42)40(22)2/h4,8-9,11-12,16-17,22,25,29-30,32,38-39H,3,5-7,10,13-15,18-21H2,1-2H3,(H,37,41)/t22-,29?,30-,32+/m1/s1 |
| InChIKey | OSVQJTBXILTETF-SVKJJKAOSA-N |
| XLogP | 4.95 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.22 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |