C31H48N4O4 — CID 134444017
(7R,10R,16R)-13-cyclohexyl-10,11-dimethyl-7-(2-methylpropyl)-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione (PubChem CID 134444017) has the molecular formula C31H48N4O4 and a molecular weight of 540.75 g/mol. Its IUPAC name is (7R,10R,16R)-13-cyclohexyl-10,11-dimethyl-7-(2-methylpropyl)-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione.
| Compound Name | (7R,10R,16R)-13-cyclohexyl-10,11-dimethyl-7-(2-methylpropyl)-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione |
|---|---|
| PubChem CID | 134444017 |
| Molecular Formula | C31H48N4O4 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | (7R,10R,16R)-13-cyclohexyl-10,11-dimethyl-7-(2-methylpropyl)-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)N(C)C(=O)C(C2CCCCC2)NC[C@H]2CCc3cccc(c3O2)CCCNC1=O |
| InChI | InChI=1S/C31H48N4O4/c1-20(2)18-26-30(37)32-17-9-14-23-12-8-13-24-15-16-25(39-28(23)24)19-33-27(22-10-6-5-7-11-22)31(38)35(4)21(3)29(36)34-26/h8,12-13,20-22,25-27,33H,5-7,9-11,14-19H2,1-4H3,(H,32,37)(H,34,36)/t21-,25-,26-,27?/m1/s1 |
| InChIKey | VZFTWTOTRKHOGV-WJTNKFQJSA-N |
| XLogP | 3.36 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |