C31H42N4O4 — CID 70329209
(7R,10R,13S)-7-benzyl-10,11-dimethyl-13-propyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione (PubChem CID 70329209) has the molecular formula C31H42N4O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is (7R,10R,13S)-7-benzyl-10,11-dimethyl-13-propyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione.
| Compound Name | (7R,10R,13S)-7-benzyl-10,11-dimethyl-13-propyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione |
|---|---|
| PubChem CID | 70329209 |
| Molecular Formula | C31H42N4O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | (7R,10R,13S)-7-benzyl-10,11-dimethyl-13-propyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione |
| SMILES | CCC[C@@H]1NCC2CCc3cccc(c3O2)CCCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C31H42N4O4/c1-4-10-26-31(38)35(3)21(2)29(36)34-27(19-22-11-6-5-7-12-22)30(37)32-18-9-15-23-13-8-14-24-16-17-25(20-33-26)39-28(23)24/h5-8,11-14,21,25-27,33H,4,9-10,15-20H2,1-3H3,(H,32,37)(H,34,36)/t21-,25?,26+,27-/m1/s1 |
| InChIKey | BKBGXNODZRLDBU-JQXFEWAVSA-N |
| XLogP | 2.78 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |