C31H44N4O5 — CID 24969606
(3R,6S,9R,12R)-12-[(4-methoxyphenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 24969606) has the molecular formula C31H44N4O5 and a molecular weight of 552.72 g/mol. Its IUPAC name is (3R,6S,9R,12R)-12-[(4-methoxyphenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R)-12-[(4-methoxyphenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 24969606 |
| Molecular Formula | C31H44N4O5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (3R,6S,9R,12R)-12-[(4-methoxyphenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CCC[C@@H]1NC[C@@H](C)Oc2ccccc2CCCNC(=O)[C@@H](Cc2ccc(OC)cc2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C31H44N4O5/c1-6-10-26-31(38)35(4)22(3)29(36)34-27(19-23-14-16-25(39-5)17-15-23)30(37)32-18-9-12-24-11-7-8-13-28(24)40-21(2)20-33-26/h7-8,11,13-17,21-22,26-27,33H,6,9-10,12,18-20H2,1-5H3,(H,32,37)(H,34,36)/t21-,22-,26+,27-/m1/s1 |
| InChIKey | DLZIXNFHTSJWNC-PDMAMLTQSA-N |
| XLogP | 2.86 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |