C30H43N5O4 — CID 59778915
(3R,6S,9R,12R)-12-benzyl-6-butan-2-yl-3,8,9-trimethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 59778915) has the molecular formula C30H43N5O4 and a molecular weight of 537.71 g/mol. Its IUPAC name is (3R,6S,9R,12R)-12-benzyl-6-butan-2-yl-3,8,9-trimethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R)-12-benzyl-6-butan-2-yl-3,8,9-trimethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 59778915 |
| Molecular Formula | C30H43N5O4 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | (3R,6S,9R,12R)-12-benzyl-6-butan-2-yl-3,8,9-trimethyl-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | CCC(C)[C@@H]1NC[C@@H](C)Oc2cccnc2CCCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C30H43N5O4/c1-6-20(2)27-30(38)35(5)22(4)28(36)34-25(18-23-12-8-7-9-13-23)29(37)32-17-10-14-24-26(15-11-16-31-24)39-21(3)19-33-27/h7-9,11-13,15-16,20-22,25,27,33H,6,10,14,17-19H2,1-5H3,(H,32,37)(H,34,36)/t20?,21-,22-,25-,27+/m1/s1 |
| InChIKey | KHHKTVCQWQPWFV-UEOLFQNYSA-N |
| XLogP | 2.49 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |