C27H45N5O4 — CID 24970115
(3R,6S,9R,12R)-6-butan-2-yl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 24970115) has the molecular formula C27H45N5O4 and a molecular weight of 503.69 g/mol. Its IUPAC name is (3R,6S,9R,12R)-6-butan-2-yl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R)-6-butan-2-yl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 24970115 |
| Molecular Formula | C27H45N5O4 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | (3R,6S,9R,12R)-6-butan-2-yl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | CCC(C)[C@@H]1NC[C@@H](C)Oc2cccnc2CCCNC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C27H45N5O4/c1-8-18(4)24-27(35)32(7)20(6)25(33)31-22(15-17(2)3)26(34)29-14-9-11-21-23(12-10-13-28-21)36-19(5)16-30-24/h10,12-13,17-20,22,24,30H,8-9,11,14-16H2,1-7H3,(H,29,34)(H,31,33)/t18?,19-,20-,22-,24+/m1/s1 |
| InChIKey | ISGYEIAGSBQWSY-NZYBIYNJSA-N |
| XLogP | 2.29 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |