C28H45FN4O4 — CID 24970112
(3R,6S,9R,12R)-6-butan-2-yl-22-fluoro-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 24970112) has the molecular formula C28H45FN4O4 and a molecular weight of 520.69 g/mol. Its IUPAC name is (3R,6S,9R,12R)-6-butan-2-yl-22-fluoro-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R)-6-butan-2-yl-22-fluoro-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 24970112 |
| Molecular Formula | C28H45FN4O4 |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | (3R,6S,9R,12R)-6-butan-2-yl-22-fluoro-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | CCC(C)C1NC[C@@H](C)Oc2c(F)cccc2CCCNC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C28H45FN4O4/c1-8-18(4)24-28(36)33(7)20(6)26(34)32-23(15-17(2)3)27(35)30-14-10-12-21-11-9-13-22(29)25(21)37-19(5)16-31-24/h9,11,13,17-20,23-24,31H,8,10,12,14-16H2,1-7H3,(H,30,35)(H,32,34)/t18?,19-,20-,23-,24?/m1/s1 |
| InChIKey | KNLQTFYKYDLITR-UVBPVUQNSA-N |
| XLogP | 3.04 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |