C32H40Br2N4O6 — CID 59778854
[2,6-dibromo-4-[[(3R,6S,9R,12R)-6-cyclopropyl-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]phenyl] acetate (PubChem CID 59778854) has the molecular formula C32H40Br2N4O6 and a molecular weight of 736.50 g/mol. Its IUPAC name is [2,6-dibromo-4-[[(3R,6S,9R,12R)-6-cyclopropyl-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]phenyl] acetate.
| Compound Name | [2,6-dibromo-4-[[(3R,6S,9R,12R)-6-cyclopropyl-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 59778854 |
| Molecular Formula | C32H40Br2N4O6 |
| Molecular Weight | 736.50 g/mol |
| Exact Mass | 734.13 |
| IUPAC Name | [2,6-dibromo-4-[[(3R,6S,9R,12R)-6-cyclopropyl-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(Br)cc(C[C@H]2NC(=O)[C@@H](C)N(C)C(=O)[C@H](C3CC3)NC[C@@H](C)Oc3ccccc3CCCNC2=O)cc1Br |
| InChI | InChI=1S/C32H40Br2N4O6/c1-18-17-36-28(23-11-12-23)32(42)38(4)19(2)30(40)37-26(16-21-14-24(33)29(25(34)15-21)44-20(3)39)31(41)35-13-7-9-22-8-5-6-10-27(22)43-18/h5-6,8,10,14-15,18-19,23,26,28,36H,7,9,11-13,16-17H2,1-4H3,(H,35,41)(H,37,40)/t18-,19-,26-,28+/m1/s1 |
| InChIKey | RMVNZNJGGYSFHC-PPGSSFKCSA-N |
| XLogP | 3.91 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|