C30H39FN4O5 — CID 24969339
(6S,9R,12R,15S)-6-cyclopropyl-21-fluoro-12-[(4-hydroxyphenyl)methyl]-8,9,15-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 24969339) has the molecular formula C30H39FN4O5 and a molecular weight of 554.66 g/mol. Its IUPAC name is (6S,9R,12R,15S)-6-cyclopropyl-21-fluoro-12-[(4-hydroxyphenyl)methyl]-8,9,15-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (6S,9R,12R,15S)-6-cyclopropyl-21-fluoro-12-[(4-hydroxyphenyl)methyl]-8,9,15-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 24969339 |
| Molecular Formula | C30H39FN4O5 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | (6S,9R,12R,15S)-6-cyclopropyl-21-fluoro-12-[(4-hydroxyphenyl)methyl]-8,9,15-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | C[C@@H]1C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](C)CCc2ccc(F)cc2OCCN[C@@H](C2CC2)C(=O)N1C |
| InChI | InChI=1S/C30H39FN4O5/c1-18-4-7-21-10-11-23(31)17-26(21)40-15-14-32-27(22-8-9-22)30(39)35(3)19(2)28(37)34-25(29(38)33-18)16-20-5-12-24(36)13-6-20/h5-6,10-13,17-19,22,25,27,32,36H,4,7-9,14-16H2,1-3H3,(H,33,38)(H,34,37)/t18-,19+,25+,27-/m0/s1 |
| InChIKey | FOFLDBILVADYST-GNIPNZNASA-N |
| XLogP | 2.30 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |