C27H36FN5O4 — CID 70934676
(9R,12R)-6-ethyl-21-fluoro-8,9-dimethyl-12-(pyridin-4-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 70934676) has the molecular formula C27H36FN5O4 and a molecular weight of 513.61 g/mol. Its IUPAC name is (9R,12R)-6-ethyl-21-fluoro-8,9-dimethyl-12-(pyridin-4-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (9R,12R)-6-ethyl-21-fluoro-8,9-dimethyl-12-(pyridin-4-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 70934676 |
| Molecular Formula | C27H36FN5O4 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (9R,12R)-6-ethyl-21-fluoro-8,9-dimethyl-12-(pyridin-4-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | CCC1NCCOc2cc(F)ccc2CCCNC(=O)[C@@H](Cc2ccncc2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C27H36FN5O4/c1-4-22-27(36)33(3)18(2)25(34)32-23(16-19-9-12-29-13-10-19)26(35)31-11-5-6-20-7-8-21(28)17-24(20)37-15-14-30-22/h7-10,12-13,17-18,22-23,30H,4-6,11,14-16H2,1-3H3,(H,31,35)(H,32,34)/t18-,22?,23-/m1/s1 |
| InChIKey | AXJYAABAOGXHNF-GHVLARLOSA-N |
| XLogP | 1.60 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |