C33H47ClN4O5 — CID 143377304
13-butan-2-yl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;1-chloro-4-methylbenzene (PubChem CID 143377304) has the molecular formula C33H47ClN4O5 and a molecular weight of 615.22 g/mol. Its IUPAC name is 13-butan-2-yl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;1-chloro-4-methylbenzene.
| Compound Name | 13-butan-2-yl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;1-chloro-4-methylbenzene |
|---|---|
| PubChem CID | 143377304 |
| Molecular Formula | C33H47ClN4O5 |
| Molecular Weight | 615.22 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | 13-butan-2-yl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;1-chloro-4-methylbenzene |
| SMILES | CCC(C)C1NCC2CCc3cccc(c3O2)CCCNC(=O)CNC(=O)C(C(C)O)N(C)C1=O.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H40N4O5.C7H7Cl/c1-5-16(2)22-26(34)30(4)23(17(3)31)25(33)29-15-21(32)27-13-7-10-18-8-6-9-19-11-12-20(14-28-22)35-24(18)19;1-6-2-4-7(8)5-3-6/h6,8-9,16-17,20,22-23,28,31H,5,7,10-15H2,1-4H3,(H,27,32)(H,29,33);2-5H,1H3 |
| InChIKey | ILSXNWWMPNVZOG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |