C37H56N4O5 — CID 143377107
13-cyclohexyl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione;ethylbenzene;formaldehyde (PubChem CID 143377107) has the molecular formula C37H56N4O5 and a molecular weight of 636.88 g/mol. Its IUPAC name is 13-cyclohexyl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione;ethylbenzene;formaldehyde.
| Compound Name | 13-cyclohexyl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione;ethylbenzene;formaldehyde |
|---|---|
| PubChem CID | 143377107 |
| Molecular Formula | C37H56N4O5 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.43 |
| IUPAC Name | 13-cyclohexyl-10-(1-hydroxyethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,12-dione;ethylbenzene;formaldehyde |
| SMILES | C=O.CC(O)C1CNCC(=O)NCCCc2cccc3c2OC(CC3)CNC(C2CCCCC2)C(=O)N1C.CCc1ccccc1 |
| InChI | InChI=1S/C28H44N4O4.C8H10.CH2O/c1-19(33)24-17-29-18-25(34)30-15-7-12-21-10-6-11-22-13-14-23(36-27(21)22)16-31-26(28(35)32(24)2)20-8-4-3-5-9-20;1-2-8-6-4-3-5-7-8;1-2/h6,10-11,19-20,23-24,26,29,31,33H,3-5,7-9,12-18H2,1-2H3,(H,30,34);3-7H,2H2,1H3;1H2 |
| InChIKey | FNFXTQHVPPXARW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |