C32H46N4O5 — CID 143377297
13-butan-2-yl-10-(hydroxymethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;toluene (PubChem CID 143377297) has the molecular formula C32H46N4O5 and a molecular weight of 566.74 g/mol. Its IUPAC name is 13-butan-2-yl-10-(hydroxymethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;toluene.
| Compound Name | 13-butan-2-yl-10-(hydroxymethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;toluene |
|---|---|
| PubChem CID | 143377297 |
| Molecular Formula | C32H46N4O5 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | 13-butan-2-yl-10-(hydroxymethyl)-11-methyl-24-oxa-5,8,11,14-tetrazatricyclo[14.6.2.019,23]tetracosa-1(23),19,21-triene-6,9,12-trione;toluene |
| SMILES | CCC(C)C1NCC2CCc3cccc(c3O2)CCCNC(=O)CNC(=O)C(CO)N(C)C1=O.Cc1ccccc1 |
| InChI | InChI=1S/C25H38N4O5.C7H8/c1-4-16(2)22-25(33)29(3)20(15-30)24(32)28-14-21(31)26-12-6-9-17-7-5-8-18-10-11-19(13-27-22)34-23(17)18;1-7-5-3-2-4-6-7/h5,7-8,16,19-20,22,27,30H,4,6,9-15H2,1-3H3,(H,26,31)(H,28,32);2-6H,1H3 |
| InChIKey | LVNGXRUABZAQHA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |