C32H44N4O5 — CID 143377285
(6S,9S,12R,15Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-12-(2-phenylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),15,18,20-tetraene-7,10,13-trione (PubChem CID 143377285) has the molecular formula C32H44N4O5 and a molecular weight of 564.73 g/mol. Its IUPAC name is (6S,9S,12R,15Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-12-(2-phenylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),15,18,20-tetraene-7,10,13-trione.
| Compound Name | (6S,9S,12R,15Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-12-(2-phenylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),15,18,20-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 143377285 |
| Molecular Formula | C32H44N4O5 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | (6S,9S,12R,15Z)-6-butan-2-yl-9-(1-hydroxyethyl)-8-methyl-12-(2-phenylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),15,18,20-tetraene-7,10,13-trione |
| SMILES | CCC(C)[C@@H]1NCCOc2ccccc2C/C=C\NC(=O)[C@@H](CCc2ccccc2)NC(=O)[C@H](C(C)O)N(C)C1=O |
| InChI | InChI=1S/C32H44N4O5/c1-5-22(2)28-32(40)36(4)29(23(3)37)31(39)35-26(18-17-24-12-7-6-8-13-24)30(38)34-19-11-15-25-14-9-10-16-27(25)41-21-20-33-28/h6-14,16,19,22-23,26,28-29,33,37H,5,15,17-18,20-21H2,1-4H3,(H,34,38)(H,35,39)/b19-11-/t22?,23?,26-,28+,29+/m1/s1 |
| InChIKey | ZXVNQNVVRWENDN-ZUTJTHFUSA-N |
| XLogP | 2.58 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |