C24H36N4O6 — CID 135099328
trans-(2S,5S)-11-(2-methoxyacetyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135099328) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is trans-(2S,5S)-11-(2-methoxyacetyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-11-(2-methoxyacetyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135099328 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | trans-(2S,5S)-11-(2-methoxyacetyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | COCC(=O)N1CCCNC(=O)[C@H](C)N(C)C(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)CCC1 |
| InChI | InChI=1S/C24H36N4O6/c1-17-23(31)25-12-6-14-28(22(30)16-33-3)13-5-7-21(29)26-20(24(32)27(17)2)15-18-8-10-19(34-4)11-9-18/h8-11,17,20H,5-7,12-16H2,1-4H3,(H,25,31)(H,26,29)/t17-,20-/m0/s1 |
| InChIKey | ZEHLPSAFKZMMOS-PXNSSMCTSA-N |
| XLogP | 0.34 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |