C34H45N5O5 — CID 135104323
(4R,7S,10R)-4-benzyl-17-(cyclopropanecarbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135104323) has the molecular formula C34H45N5O5 and a molecular weight of 603.76 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-17-(cyclopropanecarbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-17-(cyclopropanecarbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135104323 |
| Molecular Formula | C34H45N5O5 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-17-(cyclopropanecarbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccc(cc2)CN(C(=O)C2CC2)CCCCNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C34H45N5O5/c1-22(2)19-28-32(42)36-23(3)30(40)35-17-7-8-18-39(34(44)27-15-16-27)21-25-11-13-26(14-12-25)31(41)37-29(33(43)38-28)20-24-9-5-4-6-10-24/h4-6,9-14,22-23,27-29H,7-8,15-21H2,1-3H3,(H,35,40)(H,36,42)(H,37,41)(H,38,43)/t23-,28+,29-/m1/s1 |
| InChIKey | OPWKNFVVVKBQLS-LDVROUIZSA-N |
| XLogP | 2.71 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|