C38H45F2N5O5 — CID 135094943
(4R,7S,10R)-4-benzyl-17-(2,6-difluoro-3-methylbenzoyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135094943) has the molecular formula C38H45F2N5O5 and a molecular weight of 689.80 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-17-(2,6-difluoro-3-methylbenzoyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-17-(2,6-difluoro-3-methylbenzoyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135094943 |
| Molecular Formula | C38H45F2N5O5 |
| Molecular Weight | 689.80 g/mol |
| Exact Mass | 689.34 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-17-(2,6-difluoro-3-methylbenzoyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | Cc1ccc(F)c(C(=O)N2CCCCNC(=O)[C@@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc3ccccc3)NC(=O)c3ccc(cc3)C2)c1F |
| InChI | InChI=1S/C38H45F2N5O5/c1-23(2)20-30-36(48)42-25(4)34(46)41-18-8-9-19-45(38(50)32-29(39)17-12-24(3)33(32)40)22-27-13-15-28(16-14-27)35(47)43-31(37(49)44-30)21-26-10-6-5-7-11-26/h5-7,10-17,23,25,30-31H,8-9,18-22H2,1-4H3,(H,41,46)(H,42,48)(H,43,47)(H,44,49)/t25-,30+,31-/m1/s1 |
| InChIKey | FRSHLZWFFNKFQZ-SDDUWZMOSA-N |
| XLogP | 4.20 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|