C36H45N7O5 — CID 135119256
(4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-(5-methylpyrazine-2-carbonyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135119256) has the molecular formula C36H45N7O5 and a molecular weight of 655.80 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-(5-methylpyrazine-2-carbonyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-(5-methylpyrazine-2-carbonyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135119256 |
| Molecular Formula | C36H45N7O5 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-10-methyl-7-(2-methylpropyl)-17-(5-methylpyrazine-2-carbonyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | Cc1cnc(C(=O)N2CCCCNC(=O)[C@@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc3ccccc3)NC(=O)c3ccc(cc3)C2)cn1 |
| InChI | InChI=1S/C36H45N7O5/c1-23(2)18-29-34(46)40-25(4)32(44)37-16-8-9-17-43(36(48)31-21-38-24(3)20-39-31)22-27-12-14-28(15-13-27)33(45)41-30(35(47)42-29)19-26-10-6-5-7-11-26/h5-7,10-15,20-21,23,25,29-30H,8-9,16-19,22H2,1-4H3,(H,37,44)(H,40,46)(H,41,45)(H,42,47)/t25-,29+,30-/m1/s1 |
| InChIKey | OIRWRKWRJCQMAF-TZFWCWEWSA-N |
| XLogP | 2.71 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|