C36H46N6O5S — CID 135104511
(4R,7S,10R)-4-benzyl-17-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone (PubChem CID 135104511) has the molecular formula C36H46N6O5S and a molecular weight of 674.87 g/mol. Its IUPAC name is (4R,7S,10R)-4-benzyl-17-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone.
| Compound Name | (4R,7S,10R)-4-benzyl-17-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135104511 |
| Molecular Formula | C36H46N6O5S |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | (4R,7S,10R)-4-benzyl-17-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-methyl-7-(2-methylpropyl)-3,6,9,12,17-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-2,5,8,11-tetrone |
| SMILES | Cc1nc(C)c(C(=O)N2CCCCNC(=O)[C@@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc3ccccc3)NC(=O)c3ccc(cc3)C2)s1 |
| InChI | InChI=1S/C36H46N6O5S/c1-22(2)19-29-34(45)39-24(4)32(43)37-17-9-10-18-42(36(47)31-23(3)38-25(5)48-31)21-27-13-15-28(16-14-27)33(44)40-30(35(46)41-29)20-26-11-7-6-8-12-26/h6-8,11-16,22,24,29-30H,9-10,17-21H2,1-5H3,(H,37,43)(H,39,45)(H,40,44)(H,41,46)/t24-,29+,30-/m1/s1 |
| InChIKey | XKKSNIBOVJOROY-NRSKXHDUSA-N |
| XLogP | 3.69 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|